C24H32ClN3O2S — CID 4674618
3-(3-chloro-2-methylphenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 4674618) has the molecular formula C24H32ClN3O2S and a molecular weight of 462.06 g/mol. Its IUPAC name is 3-(3-chloro-2-methylphenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 3-(3-chloro-2-methylphenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 4674618 |
| Molecular Formula | C24H32ClN3O2S |
| Molecular Weight | 462.06 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 3-(3-chloro-2-methylphenyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | COc1ccc(CCN(C(=S)Nc2cccc(Cl)c2C)C2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C24H32ClN3O2S/c1-17-20(25)6-5-7-21(17)26-24(31)28(19-11-13-27(2)14-12-19)15-10-18-8-9-22(29-3)23(16-18)30-4/h5-9,16,19H,10-15H2,1-4H3,(H,26,31) |
| InChIKey | ZKEYZHFNQHOXNO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|