C20H23ClN2O2S — CID 7677144
(1R)-N-(3-chloro-2-methylphenyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 7677144) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is (1R)-N-(3-chloro-2-methylphenyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1R)-N-(3-chloro-2-methylphenyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 7677144 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (1R)-N-(3-chloro-2-methylphenyl)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](C)N(C(=S)Nc1cccc(Cl)c1C)CC2 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-12-16(21)6-5-7-17(12)22-20(26)23-9-8-14-10-18(24-3)19(25-4)11-15(14)13(23)2/h5-7,10-11,13H,8-9H2,1-4H3,(H,22,26)/t13-/m1/s1 |
| InChIKey | SMPJMVILDRQEJN-CYBMUJFWSA-N |
| XLogP | 4.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|