C30H34N2O5S — CID 2153460
ethyl 4-[[(1R)-2-[(2,3-dimethylphenyl)carbamothioyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate (PubChem CID 2153460) has the molecular formula C30H34N2O5S and a molecular weight of 534.68 g/mol. Its IUPAC name is ethyl 4-[[(1R)-2-[(2,3-dimethylphenyl)carbamothioyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate.
| Compound Name | ethyl 4-[[(1R)-2-[(2,3-dimethylphenyl)carbamothioyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 2153460 |
| Molecular Formula | C30H34N2O5S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | ethyl 4-[[(1R)-2-[(2,3-dimethylphenyl)carbamothioyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OC[C@H]2c3cc(OC)c(OC)cc3CCN2C(=S)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C30H34N2O5S/c1-6-36-29(33)21-10-12-23(13-11-21)37-18-26-24-17-28(35-5)27(34-4)16-22(24)14-15-32(26)30(38)31-25-9-7-8-19(2)20(25)3/h7-13,16-17,26H,6,14-15,18H2,1-5H3,(H,31,38)/t26-/m0/s1 |
| InChIKey | KZXMDCDKBGTSOI-SANMLTNESA-N |
| XLogP | 5.87 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|