C25H32N2O5S — CID 3630644
methyl 4-[[2-(tert-butylcarbamothioyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate (PubChem CID 3630644) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is methyl 4-[[2-(tert-butylcarbamothioyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[2-(tert-butylcarbamothioyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 3630644 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | methyl 4-[[2-(tert-butylcarbamothioyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC2c3cc(OC)c(OC)cc3CCN2C(=S)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H32N2O5S/c1-25(2,3)26-24(33)27-12-11-17-13-21(29-4)22(30-5)14-19(17)20(27)15-32-18-9-7-16(8-10-18)23(28)31-6/h7-10,13-14,20H,11-12,15H2,1-6H3,(H,26,33) |
| InChIKey | ZIJAWHYMFLLWOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|