C28H30N2O6S — CID 2153412
methyl 4-[[(1S)-6,7-dimethoxy-2-[(3-methoxyphenyl)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate (PubChem CID 2153412) has the molecular formula C28H30N2O6S and a molecular weight of 522.62 g/mol. Its IUPAC name is methyl 4-[[(1S)-6,7-dimethoxy-2-[(3-methoxyphenyl)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[(1S)-6,7-dimethoxy-2-[(3-methoxyphenyl)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 2153412 |
| Molecular Formula | C28H30N2O6S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | methyl 4-[[(1S)-6,7-dimethoxy-2-[(3-methoxyphenyl)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@@H]2c3cc(OC)c(OC)cc3CCN2C(=S)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C28H30N2O6S/c1-32-22-7-5-6-20(15-22)29-28(37)30-13-12-19-14-25(33-2)26(34-3)16-23(19)24(30)17-36-21-10-8-18(9-11-21)27(31)35-4/h5-11,14-16,24H,12-13,17H2,1-4H3,(H,29,37)/t24-/m1/s1 |
| InChIKey | NMTUXCSWMQEEDK-XMMPIXPASA-N |
| XLogP | 4.87 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|