C20H22N2O3S — CID 1287775
N-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioyl]benzamide (PubChem CID 1287775) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioyl]benzamide.
| Compound Name | N-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioyl]benzamide |
|---|---|
| PubChem CID | 1287775 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[(1R)-6,7-dimethoxy-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbothioyl]benzamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](C)N(C(=S)NC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C20H22N2O3S/c1-13-16-12-18(25-3)17(24-2)11-15(16)9-10-22(13)20(26)21-19(23)14-7-5-4-6-8-14/h4-8,11-13H,9-10H2,1-3H3,(H,21,23,26)/t13-/m1/s1 |
| InChIKey | SKKLGQZYGGCSKD-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|