C19H19NO4 — CID 102150725
(1R)-2-benzoyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carbaldehyde (PubChem CID 102150725) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is (1R)-2-benzoyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carbaldehyde.
| Compound Name | (1R)-2-benzoyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 102150725 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (1R)-2-benzoyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-1-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)[C@H](C=O)N(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C19H19NO4/c1-23-17-10-14-8-9-20(19(22)13-6-4-3-5-7-13)16(12-21)15(14)11-18(17)24-2/h3-7,10-12,16H,8-9H2,1-2H3/t16-/m0/s1 |
| InChIKey | JWHGHSJHSJCHQE-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|