C33H31NO3 — CID 175945040
[6,7-dimethoxy-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[4-(2-phenylethenyl)phenyl]methanone (PubChem CID 175945040) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is [6,7-dimethoxy-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[4-(2-phenylethenyl)phenyl]methanone.
| Compound Name | [6,7-dimethoxy-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[4-(2-phenylethenyl)phenyl]methanone |
|---|---|
| PubChem CID | 175945040 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [6,7-dimethoxy-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-2-yl]-[4-(2-phenylethenyl)phenyl]methanone |
| SMILES | COc1cc2c(cc1OC)C(c1ccc(C)cc1)N(C(=O)c1ccc(C=Cc3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C33H31NO3/c1-23-9-15-26(16-10-23)32-29-22-31(37-3)30(36-2)21-28(29)19-20-34(32)33(35)27-17-13-25(14-18-27)12-11-24-7-5-4-6-8-24/h4-18,21-22,32H,19-20H2,1-3H3 |
| InChIKey | YHESWIOKPVFEEN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|