C15H15ClN2S2 — CID 6925831
(4R)-N-(2-chlorophenyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide (PubChem CID 6925831) has the molecular formula C15H15ClN2S2 and a molecular weight of 322.89 g/mol. Its IUPAC name is (4R)-N-(2-chlorophenyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide.
| Compound Name | (4R)-N-(2-chlorophenyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 6925831 |
| Molecular Formula | C15H15ClN2S2 |
| Molecular Weight | 322.89 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (4R)-N-(2-chlorophenyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioamide |
| SMILES | C[C@@H]1c2ccsc2CCN1C(=S)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN2S2/c1-10-11-7-9-20-14(11)6-8-18(10)15(19)17-13-5-3-2-4-12(13)16/h2-5,7,9-10H,6,8H2,1H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | PPGVXFIVCCGTDA-SNVBAGLBSA-N |
| XLogP | 4.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.89 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|