C16H15ClN2OS2 — CID 7188888
4-chloro-N-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl]benzamide (PubChem CID 7188888) has the molecular formula C16H15ClN2OS2 and a molecular weight of 350.90 g/mol. Its IUPAC name is 4-chloro-N-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl]benzamide.
| Compound Name | 4-chloro-N-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl]benzamide |
|---|---|
| PubChem CID | 7188888 |
| Molecular Formula | C16H15ClN2OS2 |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 4-chloro-N-[(4S)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carbothioyl]benzamide |
| SMILES | C[C@H]1c2ccsc2CCN1C(=S)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2OS2/c1-10-13-7-9-22-14(13)6-8-19(10)16(21)18-15(20)11-2-4-12(17)5-3-11/h2-5,7,9-10H,6,8H2,1H3,(H,18,20,21)/t10-/m0/s1 |
| InChIKey | XVPVSGSXGZTJEZ-JTQLQIEISA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|