C11H13ClN2O2S — CID 55010144
N-(2-chloroacetyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 55010144) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is N-(2-chloroacetyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | N-(2-chloroacetyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 55010144 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(2-chloroacetyl)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CC1c2ccsc2CCN1C(=O)NC(=O)CCl |
| InChI | InChI=1S/C11H13ClN2O2S/c1-7-8-3-5-17-9(8)2-4-14(7)11(16)13-10(15)6-12/h3,5,7H,2,4,6H2,1H3,(H,13,15,16) |
| InChIKey | RRFCDUHVALYBMS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|