C15H24N2OS — CID 97024976
(4R)-4-methyl-N-(4-methylpentyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 97024976) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is (4R)-4-methyl-N-(4-methylpentyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | (4R)-4-methyl-N-(4-methylpentyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 97024976 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (4R)-4-methyl-N-(4-methylpentyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CC(C)CCCNC(=O)N1CCc2sccc2[C@H]1C |
| InChI | InChI=1S/C15H24N2OS/c1-11(2)5-4-8-16-15(18)17-9-6-14-13(12(17)3)7-10-19-14/h7,10-12H,4-6,8-9H2,1-3H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | SGWOPTIZFIJKJE-GFCCVEGCSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|