C15H21N5OS — CID 53498622
4-ethyl-N-[3-(1,2,4-triazol-1-yl)propyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 53498622) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is 4-ethyl-N-[3-(1,2,4-triazol-1-yl)propyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | 4-ethyl-N-[3-(1,2,4-triazol-1-yl)propyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 53498622 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-ethyl-N-[3-(1,2,4-triazol-1-yl)propyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CCC1c2ccsc2CCN1C(=O)NCCCn1cncn1 |
| InChI | InChI=1S/C15H21N5OS/c1-2-13-12-5-9-22-14(12)4-8-20(13)15(21)17-6-3-7-19-11-16-10-18-19/h5,9-11,13H,2-4,6-8H2,1H3,(H,17,21) |
| InChIKey | OEYSWJWGPXIZCR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|