C19H22N4OS — CID 71940919
N-[3-(benzimidazol-1-yl)propyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 71940919) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 71940919 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | CC1c2ccsc2CCN1C(=O)NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C19H22N4OS/c1-14-15-8-12-25-18(15)7-11-23(14)19(24)20-9-4-10-22-13-21-16-5-2-3-6-17(16)22/h2-3,5-6,8,12-14H,4,7,9-11H2,1H3,(H,20,24) |
| InChIKey | JIAKWXNBFQHEIH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|