C16H20N4O2S — CID 100816417
(3R)-N-[3-(benzimidazol-1-yl)propyl]-5-oxo-1,4-thiazepane-3-carboxamide (PubChem CID 100816417) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is (3R)-N-[3-(benzimidazol-1-yl)propyl]-5-oxo-1,4-thiazepane-3-carboxamide.
| Compound Name | (3R)-N-[3-(benzimidazol-1-yl)propyl]-5-oxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 100816417 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (3R)-N-[3-(benzimidazol-1-yl)propyl]-5-oxo-1,4-thiazepane-3-carboxamide |
| SMILES | O=C1CCSC[C@@H](C(=O)NCCCn2cnc3ccccc32)N1 |
| InChI | InChI=1S/C16H20N4O2S/c21-15-6-9-23-10-13(19-15)16(22)17-7-3-8-20-11-18-12-4-1-2-5-14(12)20/h1-2,4-5,11,13H,3,6-10H2,(H,17,22)(H,19,21)/t13-/m0/s1 |
| InChIKey | GWVJXXMAWFOHIQ-ZDUSSCGKSA-N |
| XLogP | 1.16 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|