C20H19N3O3 — CID 94491723
(3S)-N-[3-(benzimidazol-1-yl)propyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide (PubChem CID 94491723) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is (3S)-N-[3-(benzimidazol-1-yl)propyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide.
| Compound Name | (3S)-N-[3-(benzimidazol-1-yl)propyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
|---|---|
| PubChem CID | 94491723 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (3S)-N-[3-(benzimidazol-1-yl)propyl]-1-oxo-3,4-dihydroisochromene-3-carboxamide |
| SMILES | O=C1O[C@H](C(=O)NCCCn2cnc3ccccc32)Cc2ccccc21 |
| InChI | InChI=1S/C20H19N3O3/c24-19(18-12-14-6-1-2-7-15(14)20(25)26-18)21-10-5-11-23-13-22-16-8-3-4-9-17(16)23/h1-4,6-9,13,18H,5,10-12H2,(H,21,24)/t18-/m0/s1 |
| InChIKey | OTUQYWWZZUONDQ-SFHVURJKSA-N |
| XLogP | 2.32 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|