C22H23N5O3S — CID 41038096
(2S)-N-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carboxamide (PubChem CID 41038096) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is (2S)-N-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 41038096 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2S)-N-[3-(benzimidazol-1-yl)propyl]-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)[C@@H]1CCCN1C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C22H23N5O3S/c28-22(23-12-6-13-26-15-24-17-8-2-3-9-18(17)26)19-10-5-14-27(19)21-16-7-1-4-11-20(16)31(29,30)25-21/h1-4,7-9,11,15,19H,5-6,10,12-14H2,(H,23,28)/t19-/m0/s1 |
| InChIKey | UHSBFAACNLQYRR-IBGZPJMESA-N |
| XLogP | 2.16 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|