C18H25N5O3S2 — CID 9187815
1-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]-3-pentylthiourea (PubChem CID 9187815) has the molecular formula C18H25N5O3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 1-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]-3-pentylthiourea.
| Compound Name | 1-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]-3-pentylthiourea |
|---|---|
| PubChem CID | 9187815 |
| Molecular Formula | C18H25N5O3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)NNC(=O)[C@@H]1CCCN1C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H25N5O3S2/c1-2-3-6-11-19-18(27)21-20-17(24)14-9-7-12-23(14)16-13-8-4-5-10-15(13)28(25,26)22-16/h4-5,8,10,14H,2-3,6-7,9,11-12H2,1H3,(H,20,24)(H2,19,21,27)/t14-/m0/s1 |
| InChIKey | RITVTTAMBALQJT-AWEZNQCLSA-N |
| XLogP | 1.29 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|