C23H25N3O5S — CID 29204382
butyl 4-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]benzoate (PubChem CID 29204382) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is butyl 4-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 29204382 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | butyl 4-[[(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)pyrrolidine-2-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)[C@@H]2CCCN2C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-2-3-15-31-23(28)16-10-12-17(13-11-16)24-22(27)19-8-6-14-26(19)21-18-7-4-5-9-20(18)32(29,30)25-21/h4-5,7,9-13,19H,2-3,6,8,14-15H2,1H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | FZAXXEUKUXNCBJ-IBGZPJMESA-N |
| XLogP | 3.20 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|