C25H31N5O3S — CID 55935912
(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide (PubChem CID 55935912) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55935912 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(4-phenylpiperazin-1-yl)propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2)CC1)[C@@H]1CCCN1C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C25H31N5O3S/c31-25(26-13-7-14-28-16-18-29(19-17-28)20-8-2-1-3-9-20)22-11-6-15-30(22)24-21-10-4-5-12-23(21)34(32,33)27-24/h1-5,8-10,12,22H,6-7,11,13-19H2,(H,26,31)/t22-/m0/s1 |
| InChIKey | RCQVCGLXTKYNNH-QFIPXVFZSA-N |
| XLogP | 1.93 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|