C14H19N5OS — CID 94057824
(2R)-2-thiophen-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]pyrrolidine-1-carboxamide (PubChem CID 94057824) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is (2R)-2-thiophen-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]pyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-thiophen-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94057824 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (2R)-2-thiophen-3-yl-N-[3-(1,2,4-triazol-1-yl)propyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCCCn1cncn1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C14H19N5OS/c20-14(16-5-2-6-18-11-15-10-17-18)19-7-1-3-13(19)12-4-8-21-9-12/h4,8-11,13H,1-3,5-7H2,(H,16,20)/t13-/m1/s1 |
| InChIKey | OVJLRWSDLQZXTD-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|