C17H22N2O3S — CID 94030226
(2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide (PubChem CID 94030226) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94030226 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2R)-N-[3-(furan-2-ylmethoxy)propyl]-2-thiophen-3-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)N1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C17H22N2O3S/c20-17(18-7-3-9-21-12-15-4-2-10-22-15)19-8-1-5-16(19)14-6-11-23-13-14/h2,4,6,10-11,13,16H,1,3,5,7-9,12H2,(H,18,20)/t16-/m1/s1 |
| InChIKey | VWKMTMMTPADHCO-MRXNPFEDSA-N |
| XLogP | 3.79 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|