C16H26N2O4 — CID 86843944
3-ethoxy-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide (PubChem CID 86843944) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-ethoxy-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide.
| Compound Name | 3-ethoxy-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86843944 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 3-ethoxy-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
| SMILES | CCOC1CCCN(C(=O)NCCCOCc2ccco2)C1 |
| InChI | InChI=1S/C16H26N2O4/c1-2-21-14-6-3-9-18(12-14)16(19)17-8-5-10-20-13-15-7-4-11-22-15/h4,7,11,14H,2-3,5-6,8-10,12-13H2,1H3,(H,17,19) |
| InChIKey | XIWDRPPRDZSROF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|