C21H35N3O3 — CID 55794043
4-(azepan-1-ylmethyl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide (PubChem CID 55794043) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-(azepan-1-ylmethyl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide.
| Compound Name | 4-(azepan-1-ylmethyl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 55794043 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 4-(azepan-1-ylmethyl)-N-[3-(furan-2-ylmethoxy)propyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCCOCc1ccco1)N1CCC(CN2CCCCCC2)CC1 |
| InChI | InChI=1S/C21H35N3O3/c25-21(22-10-6-15-26-18-20-7-5-16-27-20)24-13-8-19(9-14-24)17-23-11-3-1-2-4-12-23/h5,7,16,19H,1-4,6,8-15,17-18H2,(H,22,25) |
| InChIKey | SQCWTNQICPMZOB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|