C17H27N3O3 — CID 100836192
1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 100836192) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 100836192 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | O=C(NCCCOCc1ccco1)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H27N3O3/c21-17(18-8-4-11-22-13-14-5-3-12-23-14)19-15-7-10-20-9-2-1-6-16(15)20/h3,5,12,15-16H,1-2,4,6-11,13H2,(H2,18,19,21)/t15-,16+/m1/s1 |
| InChIKey | DAPLLRNSYSNNPA-CVEARBPZSA-N |
| XLogP | 2.11 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|