C17H26N2O4 — CID 100893850
1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea (PubChem CID 100893850) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea.
| Compound Name | 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
|---|---|
| PubChem CID | 100893850 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[3-(furan-2-ylmethoxy)propyl]urea |
| SMILES | CC1(C)[C@H](NC(=O)NCCCOCc2ccco2)[C@@H]2CCO[C@H]21 |
| InChI | InChI=1S/C17H26N2O4/c1-17(2)14(13-6-10-23-15(13)17)19-16(20)18-7-4-8-21-11-12-5-3-9-22-12/h3,5,9,13-15H,4,6-8,10-11H2,1-2H3,(H2,18,19,20)/t13-,14+,15+/m0/s1 |
| InChIKey | DXWXUUNQMUMNBY-RRFJBIMHSA-N |
| XLogP | 2.30 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|