C19H28N2O3 — CID 100893866
1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[2-(2-phenylethoxy)ethyl]urea (PubChem CID 100893866) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[2-(2-phenylethoxy)ethyl]urea.
| Compound Name | 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[2-(2-phenylethoxy)ethyl]urea |
|---|---|
| PubChem CID | 100893866 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[(1R,5S,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]-3-[2-(2-phenylethoxy)ethyl]urea |
| SMILES | CC1(C)[C@H](NC(=O)NCCOCCc2ccccc2)[C@@H]2CCO[C@H]21 |
| InChI | InChI=1S/C19H28N2O3/c1-19(2)16(15-9-12-24-17(15)19)21-18(22)20-10-13-23-11-8-14-6-4-3-5-7-14/h3-7,15-17H,8-13H2,1-2H3,(H2,20,21,22)/t15-,16+,17+/m0/s1 |
| InChIKey | KMRQVNKZCQDSAV-GVDBMIGSSA-N |
| XLogP | 2.36 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|