C17H26N2O3 — CID 75407560
1-(4-hydroxycyclohexyl)-3-[2-(2-phenylethoxy)ethyl]urea (PubChem CID 75407560) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-[2-(2-phenylethoxy)ethyl]urea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-[2-(2-phenylethoxy)ethyl]urea |
|---|---|
| PubChem CID | 75407560 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-[2-(2-phenylethoxy)ethyl]urea |
| SMILES | O=C(NCCOCCc1ccccc1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C17H26N2O3/c20-16-8-6-15(7-9-16)19-17(21)18-11-13-22-12-10-14-4-2-1-3-5-14/h1-5,15-16,20H,6-13H2,(H2,18,19,21) |
| InChIKey | CSBYVWOXXLMSAD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|