C13H22N2O4 — CID 75431227
1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methylpropoxy)urea (PubChem CID 75431227) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methylpropoxy)urea.
| Compound Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methylpropoxy)urea |
|---|---|
| PubChem CID | 75431227 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)propyl]-3-(2-methylpropoxy)urea |
| SMILES | CC(C)CONC(=O)NCCCOCc1ccco1 |
| InChI | InChI=1S/C13H22N2O4/c1-11(2)9-19-15-13(16)14-6-4-7-17-10-12-5-3-8-18-12/h3,5,8,11H,4,6-7,9-10H2,1-2H3,(H2,14,15,16) |
| InChIKey | BBUJQEQTGJTXIC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|