C14H24N2O3 — CID 60719966
2-(butan-2-ylamino)-N-[3-(furan-2-ylmethoxy)propyl]acetamide (PubChem CID 60719966) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-N-[3-(furan-2-ylmethoxy)propyl]acetamide.
| Compound Name | 2-(butan-2-ylamino)-N-[3-(furan-2-ylmethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 60719966 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-(butan-2-ylamino)-N-[3-(furan-2-ylmethoxy)propyl]acetamide |
| SMILES | CCC(C)NCC(=O)NCCCOCc1ccco1 |
| InChI | InChI=1S/C14H24N2O3/c1-3-12(2)16-10-14(17)15-7-5-8-18-11-13-6-4-9-19-13/h4,6,9,12,16H,3,5,7-8,10-11H2,1-2H3,(H,15,17) |
| InChIKey | DUHCFZMOPFLJOI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|