C14H18N2O5S2 — CID 55678324
N-[3-(furan-2-ylmethoxy)propyl]-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 55678324) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxy)propyl]-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-[3-(furan-2-ylmethoxy)propyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 55678324 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[3-(furan-2-ylmethoxy)propyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)NCCCOCc1ccco1 |
| InChI | InChI=1S/C14H18N2O5S2/c17-13(10-16-23(18,19)14-5-2-9-22-14)15-6-3-7-20-11-12-4-1-8-21-12/h1-2,4-5,8-9,16H,3,6-7,10-11H2,(H,15,17) |
| InChIKey | YKALWHFPEULQHZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|