C13H17N3O3S — CID 62800339
2-(2-amino-1,3-thiazol-4-yl)-N-[3-(furan-2-ylmethoxy)propyl]acetamide (PubChem CID 62800339) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(furan-2-ylmethoxy)propyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(furan-2-ylmethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 62800339 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(furan-2-ylmethoxy)propyl]acetamide |
| SMILES | Nc1nc(CC(=O)NCCCOCc2ccco2)cs1 |
| InChI | InChI=1S/C13H17N3O3S/c14-13-16-10(9-20-13)7-12(17)15-4-2-5-18-8-11-3-1-6-19-11/h1,3,6,9H,2,4-5,7-8H2,(H2,14,16)(H,15,17) |
| InChIKey | OWCVMFNEJWIGLY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|