C11H15N5O3 — CID 55115340
3-amino-N-[3-(furan-2-ylmethoxy)propyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 55115340) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 55115340 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3-amino-N-[3-(furan-2-ylmethoxy)propyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NCCCOCc2ccco2)n1 |
| InChI | InChI=1S/C11H15N5O3/c12-11-14-9(15-16-11)10(17)13-4-2-5-18-7-8-3-1-6-19-8/h1,3,6H,2,4-5,7H2,(H,13,17)(H3,12,14,15,16) |
| InChIKey | GGXVYUSAPHUWOF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|