C11H13N3O2S — CID 55119881
2-(2-amino-1,3-thiazol-4-yl)-N-[2-(furan-2-yl)ethyl]acetamide (PubChem CID 55119881) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[2-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[2-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 55119881 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[2-(furan-2-yl)ethyl]acetamide |
| SMILES | Nc1nc(CC(=O)NCCc2ccco2)cs1 |
| InChI | InChI=1S/C11H13N3O2S/c12-11-14-8(7-17-11)6-10(15)13-4-3-9-2-1-5-16-9/h1-2,5,7H,3-4,6H2,(H2,12,14)(H,13,15) |
| InChIKey | ZHUNCMQOJQVMKJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |