C13H15N3OS — CID 3561835
2-(2-amino-1,3-thiazol-4-yl)-N-(2-phenylethyl)acetamide (PubChem CID 3561835) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-(2-phenylethyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 3561835 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(2-phenylethyl)acetamide |
| SMILES | Nc1nc(CC(=O)NCCc2ccccc2)cs1 |
| InChI | InChI=1S/C13H15N3OS/c14-13-16-11(9-18-13)8-12(17)15-7-6-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H2,14,16)(H,15,17) |
| InChIKey | LVDFTMZYOPQEQF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |