C21H24N4O5S — CID 91102382
2-(2-amino-1,3-thiazol-4-yl)-N-[2,3,5,6-tetrahydroxy-4-[2-(2-phenylethylamino)ethyl]phenyl]acetamide (PubChem CID 91102382) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[2,3,5,6-tetrahydroxy-4-[2-(2-phenylethylamino)ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[2,3,5,6-tetrahydroxy-4-[2-(2-phenylethylamino)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 91102382 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[2,3,5,6-tetrahydroxy-4-[2-(2-phenylethylamino)ethyl]phenyl]acetamide |
| SMILES | Nc1nc(CC(=O)Nc2c(O)c(O)c(CCNCCc3ccccc3)c(O)c2O)cs1 |
| InChI | InChI=1S/C21H24N4O5S/c22-21-24-13(11-31-21)10-15(26)25-16-19(29)17(27)14(18(28)20(16)30)7-9-23-8-6-12-4-2-1-3-5-12/h1-5,11,23,27-30H,6-10H2,(H2,22,24)(H,25,26) |
| InChIKey | NBKLDASLRCJIIT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|