C21H26Cl2N4O2S — CID 140665357
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide;dihydrochloride (PubChem CID 140665357) has the molecular formula C21H26Cl2N4O2S and a molecular weight of 469.44 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 140665357 |
| Molecular Formula | C21H26Cl2N4O2S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1nc(CC(=O)Nc2ccc(CCNC[C@@H](O)c3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C21H24N4O2S.2ClH/c22-21-25-18(14-28-21)12-20(27)24-17-8-6-15(7-9-17)10-11-23-13-19(26)16-4-2-1-3-5-16;;/h1-9,14,19,23,26H,10-13H2,(H2,22,25)(H,24,27);2*1H/t19-;;/m1../s1 |
| InChIKey | WSYDYHKUJOXZMK-JQDLGSOUSA-N |
| XLogP | 3.62 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|