C22H23N5O2S — CID 20687273
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[2-hydroxy-2-(3-isocyanophenyl)ethyl]amino]ethyl]phenyl]acetamide (PubChem CID 20687273) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[2-hydroxy-2-(3-isocyanophenyl)ethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[2-hydroxy-2-(3-isocyanophenyl)ethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 20687273 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[2-hydroxy-2-(3-isocyanophenyl)ethyl]amino]ethyl]phenyl]acetamide |
| SMILES | [C-]#[N+]c1cccc(C(O)CNCCc2ccc(NC(=O)Cc3csc(N)n3)cc2)c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-24-18-4-2-3-16(11-18)20(28)13-25-10-9-15-5-7-17(8-6-15)26-21(29)12-19-14-30-22(23)27-19/h2-8,11,14,20,25,28H,9-10,12-13H2,(H2,23,27)(H,26,29) |
| InChIKey | FWYFBOUNNXHVCS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|