C24H28N4O3S — CID 172970232
[(1R)-2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] propanoate (PubChem CID 172970232) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is [(1R)-2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] propanoate.
| Compound Name | [(1R)-2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] propanoate |
|---|---|
| PubChem CID | 172970232 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [(1R)-2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] propanoate |
| SMILES | CCC(=O)O[C@@H](CNCCc1ccc(NC(=O)Cc2csc(N)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-2-23(30)31-21(18-6-4-3-5-7-18)15-26-13-12-17-8-10-19(11-9-17)27-22(29)14-20-16-32-24(25)28-20/h3-11,16,21,26H,2,12-15H2,1H3,(H2,25,28)(H,27,29)/t21-/m0/s1 |
| InChIKey | VNFHDAGHOPMEOO-NRFANRHFSA-N |
| XLogP | 3.73 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|