C26H32N4O3S — CID 155169331
[2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] 2,2-dimethylpropanoate (PubChem CID 155169331) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is [2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155169331 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [2-[2-[4-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]phenyl]ethylamino]-1-phenylethyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(CNCCc1ccc(NC(=O)Cc2csc(N)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N4O3S/c1-26(2,3)24(32)33-22(19-7-5-4-6-8-19)16-28-14-13-18-9-11-20(12-10-18)29-23(31)15-21-17-34-25(27)30-21/h4-12,17,22,28H,13-16H2,1-3H3,(H2,27,30)(H,29,31) |
| InChIKey | NNLSLIFTWQPFSV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|