C22H23N5O2S — CID 10295740
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-(3-cyanophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]acetamide (PubChem CID 10295740) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-(3-cyanophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-(3-cyanophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10295740 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2R)-2-(3-cyanophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]acetamide |
| SMILES | N#Cc1cccc([C@@H](O)CNCCc2ccc(NC(=O)Cc3csc(N)n3)cc2)c1 |
| InChI | InChI=1S/C22H23N5O2S/c23-12-16-2-1-3-17(10-16)20(28)13-25-9-8-15-4-6-18(7-5-15)26-21(29)11-19-14-30-22(24)27-19/h1-7,10,14,20,25,28H,8-9,11,13H2,(H2,24,27)(H,26,29)/t20-/m0/s1 |
| InChIKey | KLAFFZZTFMJJHB-FQEVSTJZSA-N |
| XLogP | 2.64 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|