C29H29N5O3S — CID 15895767
2-[2-(3-cyanoanilino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide (PubChem CID 15895767) has the molecular formula C29H29N5O3S and a molecular weight of 527.65 g/mol. Its IUPAC name is 2-[2-(3-cyanoanilino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-[2-(3-cyanoanilino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 15895767 |
| Molecular Formula | C29H29N5O3S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-[2-(3-cyanoanilino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide |
| SMILES | N#Cc1cccc(Nc2nc(CC(=O)Nc3ccc(CCNC[C@H](O)COc4ccccc4)cc3)cs2)c1 |
| InChI | InChI=1S/C29H29N5O3S/c30-17-22-5-4-6-24(15-22)33-29-34-25(20-38-29)16-28(36)32-23-11-9-21(10-12-23)13-14-31-18-26(35)19-37-27-7-2-1-3-8-27/h1-12,15,20,26,31,35H,13-14,16,18-19H2,(H,32,36)(H,33,34)/t26-/m0/s1 |
| InChIKey | WPDVAGCOXRPGQC-SANMLTNESA-N |
| XLogP | 4.51 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|