C22H24N4O4S — CID 172970328
2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]-2-oxoacetamide (PubChem CID 172970328) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]-2-oxoacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 172970328 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]-2-oxoacetamide |
| SMILES | Nc1nc(C(=O)C(=O)Nc2ccc(CCNC[C@H](O)COc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C22H24N4O4S/c23-22-26-19(14-31-22)20(28)21(29)25-16-8-6-15(7-9-16)10-11-24-12-17(27)13-30-18-4-2-1-3-5-18/h1-9,14,17,24,27H,10-13H2,(H2,23,26)(H,25,29)/t17-/m0/s1 |
| InChIKey | ZTKGOEHRSIJGAA-KRWDZBQOSA-N |
| XLogP | 2.12 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|