C29H34Cl2N4O3S — CID 57386357
2-[2-(benzylamino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide;dihydrochloride (PubChem CID 57386357) has the molecular formula C29H34Cl2N4O3S and a molecular weight of 589.59 g/mol. Its IUPAC name is 2-[2-(benzylamino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide;dihydrochloride.
| Compound Name | 2-[2-(benzylamino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 57386357 |
| Molecular Formula | C29H34Cl2N4O3S |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2-[2-(benzylamino)-1,3-thiazol-4-yl]-N-[4-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethyl]phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cc1csc(NCc2ccccc2)n1)Nc1ccc(CCNC[C@H](O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C29H32N4O3S.2ClH/c34-26(20-36-27-9-5-2-6-10-27)19-30-16-15-22-11-13-24(14-12-22)32-28(35)17-25-21-37-29(33-25)31-18-23-7-3-1-4-8-23;;/h1-14,21,26,30,34H,15-20H2,(H,31,33)(H,32,35);2*1H/t26-;;/m0../s1 |
| InChIKey | PIPAZNBVKMRTJH-ROPHLPQBSA-N |
| XLogP | 5.35 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|