C23H26N4O4 — CID 56678081
N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]-2-pyrazin-2-ylacetamide (PubChem CID 56678081) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]-2-pyrazin-2-ylacetamide.
| Compound Name | N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]-2-pyrazin-2-ylacetamide |
|---|---|
| PubChem CID | 56678081 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]-2-pyrazin-2-ylacetamide |
| SMILES | O=C(Cc1cnccn1)Nc1ccc(CCNCC(O)COc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c28-20-5-7-22(8-6-20)31-16-21(29)15-24-10-9-17-1-3-18(4-2-17)27-23(30)13-19-14-25-11-12-26-19/h1-8,11-12,14,21,24,28-29H,9-10,13,15-16H2,(H,27,30) |
| InChIKey | XIOPYQYZZSGQJH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|