C24H28NO6P — CID 67683432
[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]methyl-phenylphosphinic acid (PubChem CID 67683432) has the molecular formula C24H28NO6P and a molecular weight of 457.46 g/mol. Its IUPAC name is [4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]methyl-phenylphosphinic acid.
| Compound Name | [4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]methyl-phenylphosphinic acid |
|---|---|
| PubChem CID | 67683432 |
| Molecular Formula | C24H28NO6P |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | [4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenoxy]methyl-phenylphosphinic acid |
| SMILES | O=P(O)(COc1ccc(CCNC[C@H](O)COc2ccc(O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H28NO6P/c26-20-8-12-22(13-9-20)30-17-21(27)16-25-15-14-19-6-10-23(11-7-19)31-18-32(28,29)24-4-2-1-3-5-24/h1-13,21,25-27H,14-18H2,(H,28,29)/t21-/m0/s1 |
| InChIKey | HONLWRWMIDDJCK-NRFANRHFSA-N |
| XLogP | 2.90 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|