C28H36NO7P — CID 67683624
[4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl-(3-phenylpropyl)phosphinic acid (PubChem CID 67683624) has the molecular formula C28H36NO7P and a molecular weight of 529.57 g/mol. Its IUPAC name is [4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl-(3-phenylpropyl)phosphinic acid.
| Compound Name | [4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl-(3-phenylpropyl)phosphinic acid |
|---|---|
| PubChem CID | 67683624 |
| Molecular Formula | C28H36NO7P |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | [4-[2-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methyl-(3-phenylpropyl)phosphinic acid |
| SMILES | O=P(O)(CCCc1ccccc1)COc1ccc(CCNC[C@H](O)COc2ccc(O)c(CO)c2)cc1 |
| InChI | InChI=1S/C28H36NO7P/c30-19-24-17-27(12-13-28(24)32)35-20-25(31)18-29-15-14-23-8-10-26(11-9-23)36-21-37(33,34)16-4-7-22-5-2-1-3-6-22/h1-3,5-6,8-13,17,25,29-32H,4,7,14-16,18-21H2,(H,33,34)/t25-/m0/s1 |
| InChIKey | UCXRQBPUMRBCHM-VWLOTQADSA-N |
| XLogP | 3.70 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|