C25H35NO7P+ — CID 67683770
cyclohexyl-[[4-[2-[[2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methoxy]-oxophosphanium (PubChem CID 67683770) has the molecular formula C25H35NO7P+ and a molecular weight of 492.53 g/mol. Its IUPAC name is cyclohexyl-[[4-[2-[[2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methoxy]-oxophosphanium.
| Compound Name | cyclohexyl-[[4-[2-[[2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 67683770 |
| Molecular Formula | C25H35NO7P+ |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | cyclohexyl-[[4-[2-[[2-hydroxy-3-[4-hydroxy-3-(hydroxymethyl)phenoxy]propyl]amino]ethyl]phenoxy]methoxy]-oxophosphanium |
| SMILES | O=[P+](OCOc1ccc(CCNCC(O)COc2ccc(O)c(CO)c2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H34NO7P/c27-16-20-14-23(10-11-25(20)29)31-17-21(28)15-26-13-12-19-6-8-22(9-7-19)32-18-33-34(30)24-4-2-1-3-5-24/h6-11,14,21,24,26-28H,1-5,12-13,15-18H2/p+1 |
| InChIKey | WXOVZTYHTQELBA-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|