C29H39NO2 — CID 24854098
1-[4-(1-adamantyl)phenoxy]-3-[2-(4-ethylphenyl)ethylamino]propan-2-ol (PubChem CID 24854098) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)phenoxy]-3-[2-(4-ethylphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-[4-(1-adamantyl)phenoxy]-3-[2-(4-ethylphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 24854098 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | 1-[4-(1-adamantyl)phenoxy]-3-[2-(4-ethylphenyl)ethylamino]propan-2-ol |
| SMILES | CCc1ccc(CCNCC(O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C29H39NO2/c1-2-21-3-5-22(6-4-21)11-12-30-19-27(31)20-32-28-9-7-26(8-10-28)29-16-23-13-24(17-29)15-25(14-23)18-29/h3-10,23-25,27,30-31H,2,11-20H2,1H3 |
| InChIKey | ATVNWQRPGSCVGA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|