C26H40NO2+ — CID 27452544
(2R)-1-[4-(1-adamantyl)phenoxy]-3-(1-methylazepan-1-ium-1-yl)propan-2-ol (PubChem CID 27452544) has the molecular formula C26H40NO2+ and a molecular weight of 398.61 g/mol. Its IUPAC name is (2R)-1-[4-(1-adamantyl)phenoxy]-3-(1-methylazepan-1-ium-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[4-(1-adamantyl)phenoxy]-3-(1-methylazepan-1-ium-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 27452544 |
| Molecular Formula | C26H40NO2+ |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | (2R)-1-[4-(1-adamantyl)phenoxy]-3-(1-methylazepan-1-ium-1-yl)propan-2-ol |
| SMILES | C[N+]1(C[C@@H](O)COc2ccc(C34CC5CC(CC(C5)C3)C4)cc2)CCCCCC1 |
| InChI | InChI=1S/C26H40NO2/c1-27(10-4-2-3-5-11-27)18-24(28)19-29-25-8-6-23(7-9-25)26-15-20-12-21(16-26)14-22(13-20)17-26/h6-9,20-22,24,28H,2-5,10-19H2,1H3/q+1/t20?,21?,22?,24-,26?/m1/s1 |
| InChIKey | NGMSRGMCIPSJRU-UEMNXXGQSA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|